C19H29IN2O3Si — CID 137300567
tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazo-3-(2-iodophenyl)propanoate (PubChem CID 137300567) has the molecular formula C19H29IN2O3Si and a molecular weight of 488.44 g/mol. Its IUPAC name is tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazo-3-(2-iodophenyl)propanoate.
| Compound Name | tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazo-3-(2-iodophenyl)propanoate |
|---|---|
| PubChem CID | 137300567 |
| Molecular Formula | C19H29IN2O3Si |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazo-3-(2-iodophenyl)propanoate |
| SMILES | CC(C)(C)OC(=O)C(=[N+]=[N-])C(O[Si](C)(C)C(C)(C)C)c1ccccc1I |
| InChI | InChI=1S/C19H29IN2O3Si/c1-18(2,3)24-17(23)15(22-21)16(13-11-9-10-12-14(13)20)25-26(7,8)19(4,5)6/h9-12,16H,1-8H3 |
| InChIKey | WWKHXOLLXBQEHS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|