C19H30O3 — CID 102157247
methyl (3aR,6aR)-2-decyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate (PubChem CID 102157247) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is methyl (3aR,6aR)-2-decyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate.
| Compound Name | methyl (3aR,6aR)-2-decyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate |
|---|---|
| PubChem CID | 102157247 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | methyl (3aR,6aR)-2-decyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate |
| SMILES | CCCCCCCCCCC1=C(C(=O)OC)[C@H]2CC=C[C@H]2O1 |
| InChI | InChI=1S/C19H30O3/c1-3-4-5-6-7-8-9-10-13-17-18(19(20)21-2)15-12-11-14-16(15)22-17/h11,14-16H,3-10,12-13H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | SVMYRBDAXAUOKY-JKSUJKDBSA-N |
| XLogP | 4.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|