About methyl (3aR,6aR)-2-tert-butyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate
methyl (3aR,6aR)-2-tert-butyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate (PubChem CID 134972633) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is methyl (3aR,6aR)-2-tert-butyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate.
Molecular Properties
| Compound Name | methyl (3aR,6aR)-2-tert-butyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate |
| PubChem CID | 134972633 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | methyl (3aR,6aR)-2-tert-butyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate |
| SMILES | COC(=O)C1=C(C(C)(C)C)O[C@@H]2C=CC[C@H]12 |
| InChI | InChI=1S/C13H18O3/c1-13(2,3)11-10(12(14)15-4)8-6-5-7-9(8)16-11/h5,7-9H,6H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | FCYZDXAUAXEBBY-DTWKUNHWSA-N |
| XLogP | 2.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (3aR,6aR)-2-tert-butyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3aR,6aR)-2-tert-butyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate?
The IUPAC name of methyl (3aR,6aR)-2-tert-butyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate (CID 134972633) is methyl (3aR,6aR)-2-tert-butyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate.
What is the SMILES notation for methyl (3aR,6aR)-2-tert-butyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate?
The canonical SMILES for methyl (3aR,6aR)-2-tert-butyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate is COC(=O)C1=C(C(C)(C)C)O[C@@H]2C=CC[C@H]12.
What is the InChIKey of methyl (3aR,6aR)-2-tert-butyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate?
The InChIKey is FCYZDXAUAXEBBY-DTWKUNHWSA-N. The full InChI is InChI=1S/C13H18O3/c1-13(2,3)11-10(12(14)15-4)8-6-5-7-9(8)16-11/h5,7-9H,6H2,1-4H3/t8-,9+/m0/s1.
What are the key properties of methyl (3aR,6aR)-2-tert-butyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate?
methyl (3aR,6aR)-2-tert-butyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate has a molecular weight of 222.28 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3aR,6aR)-2-tert-butyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate is sourced from PubChem (CID 134972633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).