C20H31NO7 — CID 102157333
tert-butyl N-[(1R,2R)-1-(4,5-dimethoxy-3-methyl-2-prop-2-enoxyphenyl)-1,3-dihydroxypropan-2-yl]carbamate (PubChem CID 102157333) has the molecular formula C20H31NO7 and a molecular weight of 397.47 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-1-(4,5-dimethoxy-3-methyl-2-prop-2-enoxyphenyl)-1,3-dihydroxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-1-(4,5-dimethoxy-3-methyl-2-prop-2-enoxyphenyl)-1,3-dihydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 102157333 |
| Molecular Formula | C20H31NO7 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | tert-butyl N-[(1R,2R)-1-(4,5-dimethoxy-3-methyl-2-prop-2-enoxyphenyl)-1,3-dihydroxypropan-2-yl]carbamate |
| SMILES | C=CCOc1c([C@@H](O)[C@@H](CO)NC(=O)OC(C)(C)C)cc(OC)c(OC)c1C |
| InChI | InChI=1S/C20H31NO7/c1-8-9-27-17-12(2)18(26-7)15(25-6)10-13(17)16(23)14(11-22)21-19(24)28-20(3,4)5/h8,10,14,16,22-23H,1,9,11H2,2-7H3,(H,21,24)/t14-,16-/m1/s1 |
| InChIKey | IBWWJGJQKIXGRT-GDBMZVCRSA-N |
| XLogP | 2.50 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|