C12H17N — CID 102157468
N-cyclohexyl-1-cyclopenta-2,4-dien-1-ylmethanimine (PubChem CID 102157468) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is N-cyclohexyl-1-cyclopenta-2,4-dien-1-ylmethanimine.
| Compound Name | N-cyclohexyl-1-cyclopenta-2,4-dien-1-ylmethanimine |
|---|---|
| PubChem CID | 102157468 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N-cyclohexyl-1-cyclopenta-2,4-dien-1-ylmethanimine |
| SMILES | C1=CC(/C=N/C2CCCCC2)C=C1 |
| InChI | InChI=1S/C12H17N/c1-2-8-12(9-3-1)13-10-11-6-4-5-7-11/h4-7,10-12H,1-3,8-9H2/b13-10+ |
| InChIKey | HWCPVZDYDUTBKP-JLHYYAGUSA-N |
| XLogP | 3.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|