C14H19N — CID 134421514
2-(4-cyclohexa-1,5-dien-1-ylbut-1-en-2-yl)-3,4-dihydro-2H-pyrrole (PubChem CID 134421514) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-(4-cyclohexa-1,5-dien-1-ylbut-1-en-2-yl)-3,4-dihydro-2H-pyrrole.
| Compound Name | 2-(4-cyclohexa-1,5-dien-1-ylbut-1-en-2-yl)-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 134421514 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-(4-cyclohexa-1,5-dien-1-ylbut-1-en-2-yl)-3,4-dihydro-2H-pyrrole |
| SMILES | C=C(CCC1=CCCC=C1)C1CCC=N1 |
| InChI | InChI=1S/C14H19N/c1-12(14-8-5-11-15-14)9-10-13-6-3-2-4-7-13/h3,6-7,11,14H,1-2,4-5,8-10H2 |
| InChIKey | KRCJVOCJCVRVTK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|