C7H10Cl3NO2 — CID 102157538
[(E,4S)-4-hydroxypent-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 102157538) has the molecular formula C7H10Cl3NO2 and a molecular weight of 246.52 g/mol. Its IUPAC name is [(E,4S)-4-hydroxypent-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E,4S)-4-hydroxypent-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 102157538 |
| Molecular Formula | C7H10Cl3NO2 |
| Molecular Weight | 246.52 g/mol |
| Exact Mass | 244.98 |
| IUPAC Name | [(E,4S)-4-hydroxypent-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC/C=C/[C@H](C)O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H10Cl3NO2/c1-5(12)3-2-4-13-6(11)7(8,9)10/h2-3,5,11-12H,4H2,1H3/b3-2+,11-6-/t5-/m0/s1 |
| InChIKey | AVTQDWAUOUOHCM-PPZMCQSPSA-N |
| XLogP | 2.29 |
| TPSA | 53.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.52 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|