C14H26Si — CID 102159367
trimethyl-[2-(6-methylhepta-1,5-dien-2-yl)cyclopropyl]silane (PubChem CID 102159367) has the molecular formula C14H26Si and a molecular weight of 222.45 g/mol. Its IUPAC name is trimethyl-[2-(6-methylhepta-1,5-dien-2-yl)cyclopropyl]silane.
| Compound Name | trimethyl-[2-(6-methylhepta-1,5-dien-2-yl)cyclopropyl]silane |
|---|---|
| PubChem CID | 102159367 |
| Molecular Formula | C14H26Si |
| Molecular Weight | 222.45 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | trimethyl-[2-(6-methylhepta-1,5-dien-2-yl)cyclopropyl]silane |
| SMILES | C=C(CCC=C(C)C)C1CC1[Si](C)(C)C |
| InChI | InChI=1S/C14H26Si/c1-11(2)8-7-9-12(3)13-10-14(13)15(4,5)6/h8,13-14H,3,7,9-10H2,1-2,4-6H3 |
| InChIKey | KDDXEYTUCRWGNQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|