C15H18F3NO — CID 102162222
(E)-4-anilino-1,1,1-trifluoronon-3-en-2-one (PubChem CID 102162222) has the molecular formula C15H18F3NO and a molecular weight of 285.31 g/mol. Its IUPAC name is (E)-4-anilino-1,1,1-trifluoronon-3-en-2-one.
| Compound Name | (E)-4-anilino-1,1,1-trifluoronon-3-en-2-one |
|---|---|
| PubChem CID | 102162222 |
| Molecular Formula | C15H18F3NO |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | (E)-4-anilino-1,1,1-trifluoronon-3-en-2-one |
| SMILES | CCCCC/C(=C\C(=O)C(F)(F)F)Nc1ccccc1 |
| InChI | InChI=1S/C15H18F3NO/c1-2-3-5-10-13(11-14(20)15(16,17)18)19-12-8-6-4-7-9-12/h4,6-9,11,19H,2-3,5,10H2,1H3/b13-11+ |
| InChIKey | NCDSLUTYPXAXAV-ACCUITESSA-N |
| XLogP | 4.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|