C20H24O3 — CID 102164440
1,3-dimethoxy-5-[(E,2R)-2-(4-methoxyphenyl)pent-3-enyl]benzene (PubChem CID 102164440) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1,3-dimethoxy-5-[(E,2R)-2-(4-methoxyphenyl)pent-3-enyl]benzene.
| Compound Name | 1,3-dimethoxy-5-[(E,2R)-2-(4-methoxyphenyl)pent-3-enyl]benzene |
|---|---|
| PubChem CID | 102164440 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1,3-dimethoxy-5-[(E,2R)-2-(4-methoxyphenyl)pent-3-enyl]benzene |
| SMILES | C/C=C/[C@@H](Cc1cc(OC)cc(OC)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H24O3/c1-5-6-17(16-7-9-18(21-2)10-8-16)11-15-12-19(22-3)14-20(13-15)23-4/h5-10,12-14,17H,11H2,1-4H3/b6-5+/t17-/m0/s1 |
| InChIKey | QJDCIUMQSHJLSQ-RTRPANQVSA-N |
| XLogP | 4.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|