C22H21N7O — CID 102165335
4-[3-[8-amino-11-(furan-2-yl)-4,5,7,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaen-5-yl]propyl]benzenecarboximidamide (PubChem CID 102165335) has the molecular formula C22H21N7O and a molecular weight of 399.46 g/mol. Its IUPAC name is 4-[3-[8-amino-11-(furan-2-yl)-4,5,7,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaen-5-yl]propyl]benzenecarboximidamide.
| Compound Name | 4-[3-[8-amino-11-(furan-2-yl)-4,5,7,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaen-5-yl]propyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 102165335 |
| Molecular Formula | C22H21N7O |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 4-[3-[8-amino-11-(furan-2-yl)-4,5,7,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaen-5-yl]propyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CCCn2ncc3c2nc(N)n2cc(-c4ccco4)cc32)cc1 |
| InChI | InChI=1S/C22H21N7O/c23-20(24)15-7-5-14(6-8-15)3-1-9-29-21-17(12-26-29)18-11-16(19-4-2-10-30-19)13-28(18)22(25)27-21/h2,4-8,10-13H,1,3,9H2,(H3,23,24)(H2,25,27) |
| InChIKey | KHAWBGOAOBPPRE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|