C15H15Cl3N2O2 — CID 102166021
N-[(6Z)-3-benzyl-5,8-dihydro-4H-1,3-oxazocin-2-ylidene]-2,2,2-trichloroacetamide (PubChem CID 102166021) has the molecular formula C15H15Cl3N2O2 and a molecular weight of 361.66 g/mol. Its IUPAC name is N-[(6Z)-3-benzyl-5,8-dihydro-4H-1,3-oxazocin-2-ylidene]-2,2,2-trichloroacetamide.
| Compound Name | N-[(6Z)-3-benzyl-5,8-dihydro-4H-1,3-oxazocin-2-ylidene]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 102166021 |
| Molecular Formula | C15H15Cl3N2O2 |
| Molecular Weight | 361.66 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | N-[(6Z)-3-benzyl-5,8-dihydro-4H-1,3-oxazocin-2-ylidene]-2,2,2-trichloroacetamide |
| SMILES | O=C(/N=C1\OC/C=C\CCN1Cc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H15Cl3N2O2/c16-15(17,18)13(21)19-14-20(9-5-2-6-10-22-14)11-12-7-3-1-4-8-12/h1-4,6-8H,5,9-11H2/b6-2-,19-14- |
| InChIKey | SIZSHCRBDWSEPQ-JKIKHMASSA-N |
| XLogP | 3.72 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.66 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|