C18H18N2O2 — CID 11543886
1-[4-[(3-benzyl-1,3-oxazolidin-2-ylidene)amino]phenyl]ethanone (PubChem CID 11543886) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1-[4-[(3-benzyl-1,3-oxazolidin-2-ylidene)amino]phenyl]ethanone.
| Compound Name | 1-[4-[(3-benzyl-1,3-oxazolidin-2-ylidene)amino]phenyl]ethanone |
|---|---|
| PubChem CID | 11543886 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1-[4-[(3-benzyl-1,3-oxazolidin-2-ylidene)amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(/N=C2\OCCN2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H18N2O2/c1-14(21)16-7-9-17(10-8-16)19-18-20(11-12-22-18)13-15-5-3-2-4-6-15/h2-10H,11-13H2,1H3/b19-18- |
| InChIKey | JJAZMKOKAPDAEO-HNENSFHCSA-N |
| XLogP | 3.41 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|