C17H15ClN2O — CID 177388189
(5E)-3-benzyl-5-(chloromethylidene)-N-phenyl-1,3-oxazolidin-2-imine (PubChem CID 177388189) has the molecular formula C17H15ClN2O and a molecular weight of 298.77 g/mol. Its IUPAC name is (5E)-3-benzyl-5-(chloromethylidene)-N-phenyl-1,3-oxazolidin-2-imine.
| Compound Name | (5E)-3-benzyl-5-(chloromethylidene)-N-phenyl-1,3-oxazolidin-2-imine |
|---|---|
| PubChem CID | 177388189 |
| Molecular Formula | C17H15ClN2O |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (5E)-3-benzyl-5-(chloromethylidene)-N-phenyl-1,3-oxazolidin-2-imine |
| SMILES | Cl/C=C1\CN(Cc2ccccc2)/C(=N/c2ccccc2)O1 |
| InChI | InChI=1S/C17H15ClN2O/c18-11-16-13-20(12-14-7-3-1-4-8-14)17(21-16)19-15-9-5-2-6-10-15/h1-11H,12-13H2/b16-11+,19-17- |
| InChIKey | HTOWGNNZGLYXRV-UISRZRNOSA-N |
| XLogP | 4.29 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|