About 3-benzyl-2-phenylimino-1,3-thiazolidin-4-one;hydrochloride
3-benzyl-2-phenylimino-1,3-thiazolidin-4-one;hydrochloride (PubChem CID 141064791) has the molecular formula C16H15ClN2OS
and a molecular weight of 318.83 g/mol. Its IUPAC name is 3-benzyl-2-phenylimino-1,3-thiazolidin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 3-benzyl-2-phenylimino-1,3-thiazolidin-4-one;hydrochloride |
| PubChem CID | 141064791 |
| Molecular Formula | C16H15ClN2OS |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 3-benzyl-2-phenylimino-1,3-thiazolidin-4-one;hydrochloride |
| SMILES | Cl.O=C1CS/C(=N\c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C16H14N2OS.ClH/c19-15-12-20-16(17-14-9-5-2-6-10-14)18(15)11-13-7-3-1-4-8-13;/h1-10H,11-12H2;1H/b17-16-; |
| InChIKey | MHTRWCUFVPBJHZ-XYJRJTJESA-N |
| XLogP | 3.87 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-2-phenylimino-1,3-thiazolidin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-2-phenylimino-1,3-thiazolidin-4-one;hydrochloride?
The IUPAC name of 3-benzyl-2-phenylimino-1,3-thiazolidin-4-one;hydrochloride (CID 141064791) is 3-benzyl-2-phenylimino-1,3-thiazolidin-4-one;hydrochloride.
What is the SMILES notation for 3-benzyl-2-phenylimino-1,3-thiazolidin-4-one;hydrochloride?
The canonical SMILES for 3-benzyl-2-phenylimino-1,3-thiazolidin-4-one;hydrochloride is Cl.O=C1CS/C(=N\c2ccccc2)N1Cc1ccccc1.
What is the InChIKey of 3-benzyl-2-phenylimino-1,3-thiazolidin-4-one;hydrochloride?
The InChIKey is MHTRWCUFVPBJHZ-XYJRJTJESA-N. The full InChI is InChI=1S/C16H14N2OS.ClH/c19-15-12-20-16(17-14-9-5-2-6-10-14)18(15)11-13-7-3-1-4-8-13;/h1-10H,11-12H2;1H/b17-16-;.
What are the key properties of 3-benzyl-2-phenylimino-1,3-thiazolidin-4-one;hydrochloride?
3-benzyl-2-phenylimino-1,3-thiazolidin-4-one;hydrochloride has a molecular weight of 318.83 g/mol, XLogP of 3.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-2-phenylimino-1,3-thiazolidin-4-one;hydrochloride is sourced from PubChem (CID 141064791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).