C18H23N3OS — CID 118713906
(2E)-3-benzyl-2-(cyclooctylidenehydrazinylidene)-1,3-thiazolidin-4-one (PubChem CID 118713906) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is (2E)-3-benzyl-2-(cyclooctylidenehydrazinylidene)-1,3-thiazolidin-4-one.
| Compound Name | (2E)-3-benzyl-2-(cyclooctylidenehydrazinylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 118713906 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (2E)-3-benzyl-2-(cyclooctylidenehydrazinylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N/N=C2CCCCCCC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H23N3OS/c22-17-14-23-18(21(17)13-15-9-5-4-6-10-15)20-19-16-11-7-2-1-3-8-12-16/h4-6,9-10H,1-3,7-8,11-14H2/b20-18+ |
| InChIKey | PIMYGSGDWFSFQS-CZIZESTLSA-N |
| XLogP | 4.22 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|