C15H19N3OS — CID 42625457
2-phenylimino-3-(2-pyrrolidin-1-ylethyl)-1,3-thiazolidin-4-one (PubChem CID 42625457) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-phenylimino-3-(2-pyrrolidin-1-ylethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-phenylimino-3-(2-pyrrolidin-1-ylethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 42625457 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-phenylimino-3-(2-pyrrolidin-1-ylethyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N\c2ccccc2)N1CCN1CCCC1 |
| InChI | InChI=1S/C15H19N3OS/c19-14-12-20-15(16-13-6-2-1-3-7-13)18(14)11-10-17-8-4-5-9-17/h1-3,6-7H,4-5,8-12H2/b16-15- |
| InChIKey | CEXJUYJWNBJPFW-NXVVXOECSA-N |
| XLogP | 2.35 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|