C13H16N2OS — CID 46238238
2-(2-methylphenyl)imino-3-propyl-1,3-thiazolidin-4-one (PubChem CID 46238238) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-(2-methylphenyl)imino-3-propyl-1,3-thiazolidin-4-one.
| Compound Name | 2-(2-methylphenyl)imino-3-propyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 46238238 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-(2-methylphenyl)imino-3-propyl-1,3-thiazolidin-4-one |
| SMILES | CCCN1C(=O)CS/C1=N\c1ccccc1C |
| InChI | InChI=1S/C13H16N2OS/c1-3-8-15-12(16)9-17-13(15)14-11-7-5-4-6-10(11)2/h4-7H,3,8-9H2,1-2H3/b14-13- |
| InChIKey | QTIPLRGLNSQFTD-YPKPFQOOSA-N |
| XLogP | 2.97 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|