C16H13ClN2O3S2 — CID 73352526
4-[(3-benzyl-5-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonyl chloride (PubChem CID 73352526) has the molecular formula C16H13ClN2O3S2 and a molecular weight of 380.88 g/mol. Its IUPAC name is 4-[(3-benzyl-5-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonyl chloride.
| Compound Name | 4-[(3-benzyl-5-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 73352526 |
| Molecular Formula | C16H13ClN2O3S2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | 4-[(3-benzyl-5-oxo-1,3-thiazolidin-2-ylidene)amino]benzenesulfonyl chloride |
| SMILES | O=C1CN(Cc2ccccc2)/C(=N/c2ccc(S(=O)(=O)Cl)cc2)S1 |
| InChI | InChI=1S/C16H13ClN2O3S2/c17-24(21,22)14-8-6-13(7-9-14)18-16-19(11-15(20)23-16)10-12-4-2-1-3-5-12/h1-9H,10-11H2/b18-16- |
| InChIKey | ZVASZWRMMCSUAP-VLGSPTGOSA-N |
| XLogP | 3.38 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|