C13H15NO2 — CID 59575729
1-benzyl-4-(trideuteriomethyl)piperidine-2,5-dione (PubChem CID 59575729) has the molecular formula C13H15NO2 and a molecular weight of 220.29 g/mol. Its IUPAC name is 1-benzyl-4-(trideuteriomethyl)piperidine-2,5-dione.
| Compound Name | 1-benzyl-4-(trideuteriomethyl)piperidine-2,5-dione |
|---|---|
| PubChem CID | 59575729 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 1-benzyl-4-(trideuteriomethyl)piperidine-2,5-dione |
| SMILES | [2H]C([2H])([2H])C1CC(=O)N(Cc2ccccc2)CC1=O |
| InChI | InChI=1S/C13H15NO2/c1-10-7-13(16)14(9-12(10)15)8-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3/i1D3 |
| InChIKey | WUXCJFCWMFCPIG-FIBGUPNXSA-N |
| XLogP | 1.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |