C32H46N2O8 — CID 158028172
1-benzyl-5,5-dimethoxy-4-methylpiperidin-2-one;1-benzyl-4-methylpiperidine-2,5-dione;trimethoxymethane (PubChem CID 158028172) has the molecular formula C32H46N2O8 and a molecular weight of 586.73 g/mol. Its IUPAC name is 1-benzyl-5,5-dimethoxy-4-methylpiperidin-2-one;1-benzyl-4-methylpiperidine-2,5-dione;trimethoxymethane.
| Compound Name | 1-benzyl-5,5-dimethoxy-4-methylpiperidin-2-one;1-benzyl-4-methylpiperidine-2,5-dione;trimethoxymethane |
|---|---|
| PubChem CID | 158028172 |
| Molecular Formula | C32H46N2O8 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | 1-benzyl-5,5-dimethoxy-4-methylpiperidin-2-one;1-benzyl-4-methylpiperidine-2,5-dione;trimethoxymethane |
| SMILES | CC1CC(=O)N(Cc2ccccc2)CC1=O.COC(OC)OC.COC1(OC)CN(Cc2ccccc2)C(=O)CC1C |
| InChI | InChI=1S/C15H21NO3.C13H15NO2.C4H10O3/c1-12-9-14(17)16(11-15(12,18-2)19-3)10-13-7-5-4-6-8-13;1-10-7-13(16)14(9-12(10)15)8-11-5-3-2-4-6-11;1-5-4(6-2)7-3/h4-8,12H,9-11H2,1-3H3;2-6,10H,7-9H2,1H3;4H,1-3H3 |
| InChIKey | FGVVIDNZVXMVQN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|