C13H11N3O3 — CID 11715839
3-benzyl-4,8-dihydropyrimido[5,4-e][1,3]oxazine-2,7-dione (PubChem CID 11715839) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is 3-benzyl-4,8-dihydropyrimido[5,4-e][1,3]oxazine-2,7-dione.
| Compound Name | 3-benzyl-4,8-dihydropyrimido[5,4-e][1,3]oxazine-2,7-dione |
|---|---|
| PubChem CID | 11715839 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 3-benzyl-4,8-dihydropyrimido[5,4-e][1,3]oxazine-2,7-dione |
| SMILES | O=C1Oc2[nH]c(=O)ncc2CN1Cc1ccccc1 |
| InChI | InChI=1S/C13H11N3O3/c17-12-14-6-10-8-16(13(18)19-11(10)15-12)7-9-4-2-1-3-5-9/h1-6H,7-8H2,(H,14,15,17) |
| InChIKey | KVHDEISQZDLAMC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |