C22H28N2O9 — CID 159571593
1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate;3,6-dimethyl-1,4-dioxane-2,5-dione;1,3-dioxan-2-one (PubChem CID 159571593) has the molecular formula C22H28N2O9 and a molecular weight of 464.47 g/mol. Its IUPAC name is 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate;3,6-dimethyl-1,4-dioxane-2,5-dione;1,3-dioxan-2-one.
| Compound Name | 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate;3,6-dimethyl-1,4-dioxane-2,5-dione;1,3-dioxan-2-one |
|---|---|
| PubChem CID | 159571593 |
| Molecular Formula | C22H28N2O9 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 1-benzyl-3-methyl-4,5-dihydroimidazol-3-ium-2-carboxylate;3,6-dimethyl-1,4-dioxane-2,5-dione;1,3-dioxan-2-one |
| SMILES | CC1OC(=O)C(C)OC1=O.C[N+]1=C(C(=O)[O-])N(Cc2ccccc2)CC1.O=C1OCCCO1 |
| InChI | InChI=1S/C12H14N2O2.C6H8O4.C4H6O3/c1-13-7-8-14(11(13)12(15)16)9-10-5-3-2-4-6-10;1-3-5(7)10-4(2)6(8)9-3;5-4-6-2-1-3-7-4/h2-6H,7-9H2,1H3;3-4H,1-2H3;1-3H2 |
| InChIKey | NUMHKUXLORHLHA-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 134.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|