C34H29N3O5 — CID 102166320
(4S)-4-benzhydryl-3-[(2R,3S,4S)-4-methyl-2-(4-nitrophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole-3-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 102166320) has the molecular formula C34H29N3O5 and a molecular weight of 559.62 g/mol. Its IUPAC name is (4S)-4-benzhydryl-3-[(2R,3S,4S)-4-methyl-2-(4-nitrophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole-3-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzhydryl-3-[(2R,3S,4S)-4-methyl-2-(4-nitrophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole-3-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102166320 |
| Molecular Formula | C34H29N3O5 |
| Molecular Weight | 559.62 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | (4S)-4-benzhydryl-3-[(2R,3S,4S)-4-methyl-2-(4-nitrophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole-3-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H]1C(c2ccccc2)=N[C@@H](c2ccc([N+](=O)[O-])cc2)[C@H]1C(=O)N1C(=O)OC[C@@H]1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H29N3O5/c1-22-29(32(26-17-19-27(20-18-26)37(40)41)35-31(22)25-15-9-4-10-16-25)33(38)36-28(21-42-34(36)39)30(23-11-5-2-6-12-23)24-13-7-3-8-14-24/h2-20,22,28-30,32H,21H2,1H3/t22-,28+,29-,32-/m0/s1 |
| InChIKey | IQENDGHJNGCXON-CMIVRYTISA-N |
| XLogP | 6.57 |
| TPSA | 102.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.62 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|