C28H25N3O5 — CID 102166321
(4S)-3-[(2R,3S,4S)-4-ethyl-2-(4-nitrophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole-3-carbonyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 102166321) has the molecular formula C28H25N3O5 and a molecular weight of 483.52 g/mol. Its IUPAC name is (4S)-3-[(2R,3S,4S)-4-ethyl-2-(4-nitrophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole-3-carbonyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2R,3S,4S)-4-ethyl-2-(4-nitrophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole-3-carbonyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102166321 |
| Molecular Formula | C28H25N3O5 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | (4S)-3-[(2R,3S,4S)-4-ethyl-2-(4-nitrophenyl)-5-phenyl-3,4-dihydro-2H-pyrrole-3-carbonyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC[C@@H]1C(c2ccccc2)=N[C@@H](c2ccc([N+](=O)[O-])cc2)[C@H]1C(=O)N1C(=O)OC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C28H25N3O5/c1-2-22-24(27(32)30-23(17-36-28(30)33)18-9-5-3-6-10-18)26(20-13-15-21(16-14-20)31(34)35)29-25(22)19-11-7-4-8-12-19/h3-16,22-24,26H,2,17H2,1H3/t22-,23+,24-,26-/m0/s1 |
| InChIKey | FJSOBUGZKYGKIE-UHCVVMIDSA-N |
| XLogP | 5.50 |
| TPSA | 102.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|