C20H34Si2 — CID 102166744
(1R,4S)-3-butyl-1,4-dimethyl-1,4-di(propan-2-yl)-1,4-benzodisiline (PubChem CID 102166744) has the molecular formula C20H34Si2 and a molecular weight of 330.66 g/mol. Its IUPAC name is (1R,4S)-3-butyl-1,4-dimethyl-1,4-di(propan-2-yl)-1,4-benzodisiline.
| Compound Name | (1R,4S)-3-butyl-1,4-dimethyl-1,4-di(propan-2-yl)-1,4-benzodisiline |
|---|---|
| PubChem CID | 102166744 |
| Molecular Formula | C20H34Si2 |
| Molecular Weight | 330.66 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (1R,4S)-3-butyl-1,4-dimethyl-1,4-di(propan-2-yl)-1,4-benzodisiline |
| SMILES | CCCCC1=C[Si@@](C)(C(C)C)c2ccccc2[Si@@]1(C)C(C)C |
| InChI | InChI=1S/C20H34Si2/c1-8-9-12-18-15-21(6,16(2)3)19-13-10-11-14-20(19)22(18,7)17(4)5/h10-11,13-17H,8-9,12H2,1-7H3/t21-,22-/m0/s1 |
| InChIKey | KOVJCQOVYNQWNT-VXKWHMMOSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|