C16H30Si — CID 15151076
2,5-dibutyl-3-ethyl-1,1-dimethylsilole (PubChem CID 15151076) has the molecular formula C16H30Si and a molecular weight of 250.50 g/mol. Its IUPAC name is 2,5-dibutyl-3-ethyl-1,1-dimethylsilole.
| Compound Name | 2,5-dibutyl-3-ethyl-1,1-dimethylsilole |
|---|---|
| PubChem CID | 15151076 |
| Molecular Formula | C16H30Si |
| Molecular Weight | 250.50 g/mol |
| Exact Mass | 250.21 |
| IUPAC Name | 2,5-dibutyl-3-ethyl-1,1-dimethylsilole |
| SMILES | CCCCC1=CC(CC)=C(CCCC)[Si]1(C)C |
| InChI | InChI=1S/C16H30Si/c1-6-9-11-15-13-14(8-3)16(12-10-7-2)17(15,4)5/h13H,6-12H2,1-5H3 |
| InChIKey | IZNCHYPMRNKATE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|