C20H34Si — CID 139241206
(3Z)-1,5-dibutyl-3-pentylidene-4-silaspiro[3.4]octa-1,5-diene (PubChem CID 139241206) has the molecular formula C20H34Si and a molecular weight of 302.58 g/mol. Its IUPAC name is (3Z)-1,5-dibutyl-3-pentylidene-4-silaspiro[3.4]octa-1,5-diene.
| Compound Name | (3Z)-1,5-dibutyl-3-pentylidene-4-silaspiro[3.4]octa-1,5-diene |
|---|---|
| PubChem CID | 139241206 |
| Molecular Formula | C20H34Si |
| Molecular Weight | 302.58 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | (3Z)-1,5-dibutyl-3-pentylidene-4-silaspiro[3.4]octa-1,5-diene |
| SMILES | CCCC/C=C1/C=C(CCCC)[Si]12CCC=C2CCCC |
| InChI | InChI=1S/C20H34Si/c1-4-7-10-14-20-17-19(13-9-6-3)21(20)16-11-15-18(21)12-8-5-2/h14-15,17H,4-13,16H2,1-3H3/b20-14- |
| InChIKey | POGGINRSKOWJLA-ZHZULCJRSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.58 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|