C14H19ClSi — CID 102283936
(1S)-5-butyl-1-chloro-1-phenyl-2,3-dihydrosilole (PubChem CID 102283936) has the molecular formula C14H19ClSi and a molecular weight of 250.84 g/mol. Its IUPAC name is (1S)-5-butyl-1-chloro-1-phenyl-2,3-dihydrosilole.
| Compound Name | (1S)-5-butyl-1-chloro-1-phenyl-2,3-dihydrosilole |
|---|---|
| PubChem CID | 102283936 |
| Molecular Formula | C14H19ClSi |
| Molecular Weight | 250.84 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | (1S)-5-butyl-1-chloro-1-phenyl-2,3-dihydrosilole |
| SMILES | CCCCC1=CCC[Si@@]1(Cl)c1ccccc1 |
| InChI | InChI=1S/C14H19ClSi/c1-2-3-8-13-11-7-12-16(13,15)14-9-5-4-6-10-14/h4-6,9-11H,2-3,7-8,12H2,1H3/t16-/m0/s1 |
| InChIKey | IYZFZRQQSQQYAD-INIZCTEOSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.84 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|