C24H38BClSi — CID 102279337
(2,5-dibutyl-1-chloro-4-ethyl-1-phenylsilol-3-yl)-diethylborane (PubChem CID 102279337) has the molecular formula C24H38BClSi and a molecular weight of 400.92 g/mol. Its IUPAC name is (2,5-dibutyl-1-chloro-4-ethyl-1-phenylsilol-3-yl)-diethylborane.
| Compound Name | (2,5-dibutyl-1-chloro-4-ethyl-1-phenylsilol-3-yl)-diethylborane |
|---|---|
| PubChem CID | 102279337 |
| Molecular Formula | C24H38BClSi |
| Molecular Weight | 400.92 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | (2,5-dibutyl-1-chloro-4-ethyl-1-phenylsilol-3-yl)-diethylborane |
| SMILES | CCCCC1=C(CC)C(B(CC)CC)=C(CCCC)[Si]1(Cl)c1ccccc1 |
| InChI | InChI=1S/C24H38BClSi/c1-6-11-18-22-21(8-3)24(25(9-4)10-5)23(19-12-7-2)27(22,26)20-16-14-13-15-17-20/h13-17H,6-12,18-19H2,1-5H3 |
| InChIKey | TXXOGSUNOGJUBX-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.92 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|