C26H41BSi — CID 102297926
(2,5-dibutyl-1-ethenyl-4-ethyl-1-phenylsilol-3-yl)-diethylborane (PubChem CID 102297926) has the molecular formula C26H41BSi and a molecular weight of 392.51 g/mol. Its IUPAC name is (2,5-dibutyl-1-ethenyl-4-ethyl-1-phenylsilol-3-yl)-diethylborane.
| Compound Name | (2,5-dibutyl-1-ethenyl-4-ethyl-1-phenylsilol-3-yl)-diethylborane |
|---|---|
| PubChem CID | 102297926 |
| Molecular Formula | C26H41BSi |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | (2,5-dibutyl-1-ethenyl-4-ethyl-1-phenylsilol-3-yl)-diethylborane |
| SMILES | C=C[Si]1(c2ccccc2)C(CCCC)=C(CC)C(B(CC)CC)=C1CCCC |
| InChI | InChI=1S/C26H41BSi/c1-7-13-20-24-23(9-3)26(27(10-4)11-5)25(21-14-8-2)28(24,12-6)22-18-16-15-17-19-22/h12,15-19H,6-11,13-14,20-21H2,1-5H3 |
| InChIKey | VKLVRGIIQVLSNR-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|