C14H23NO — CID 134894496
6-[(E)-non-4-enyl]-3,4-dihydro-1H-pyridin-2-one (PubChem CID 134894496) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 6-[(E)-non-4-enyl]-3,4-dihydro-1H-pyridin-2-one.
| Compound Name | 6-[(E)-non-4-enyl]-3,4-dihydro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 134894496 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 6-[(E)-non-4-enyl]-3,4-dihydro-1H-pyridin-2-one |
| SMILES | CCCC/C=C/CCCC1=CCCC(=O)N1 |
| InChI | InChI=1S/C14H23NO/c1-2-3-4-5-6-7-8-10-13-11-9-12-14(16)15-13/h5-6,11H,2-4,7-10,12H2,1H3,(H,15,16)/b6-5+ |
| InChIKey | XIALAYGQVJTRHZ-AATRIKPKSA-N |
| XLogP | 3.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|