C19H25NO — CID 11076941
6-[(Z)-hex-1-enyl]-1-[(1R)-1-phenylethyl]-3,4-dihydropyridin-2-one (PubChem CID 11076941) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is 6-[(Z)-hex-1-enyl]-1-[(1R)-1-phenylethyl]-3,4-dihydropyridin-2-one.
| Compound Name | 6-[(Z)-hex-1-enyl]-1-[(1R)-1-phenylethyl]-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 11076941 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 6-[(Z)-hex-1-enyl]-1-[(1R)-1-phenylethyl]-3,4-dihydropyridin-2-one |
| SMILES | CCCC/C=C\C1=CCCC(=O)N1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C19H25NO/c1-3-4-5-9-13-18-14-10-15-19(21)20(18)16(2)17-11-7-6-8-12-17/h6-9,11-14,16H,3-5,10,15H2,1-2H3/b13-9-/t16-/m1/s1 |
| InChIKey | WUFPQFPMXALRQB-RCBBPTIPSA-N |
| XLogP | 5.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|