C21H19NO — CID 11055737
1-[(1R)-1-phenylethyl]-6-(2-phenylethynyl)-3,4-dihydropyridin-2-one (PubChem CID 11055737) has the molecular formula C21H19NO and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-[(1R)-1-phenylethyl]-6-(2-phenylethynyl)-3,4-dihydropyridin-2-one.
| Compound Name | 1-[(1R)-1-phenylethyl]-6-(2-phenylethynyl)-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 11055737 |
| Molecular Formula | C21H19NO |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1-[(1R)-1-phenylethyl]-6-(2-phenylethynyl)-3,4-dihydropyridin-2-one |
| SMILES | C[C@H](c1ccccc1)N1C(=O)CCC=C1C#Cc1ccccc1 |
| InChI | InChI=1S/C21H19NO/c1-17(19-11-6-3-7-12-19)22-20(13-8-14-21(22)23)16-15-18-9-4-2-5-10-18/h2-7,9-13,17H,8,14H2,1H3/t17-/m1/s1 |
| InChIKey | PAOCMQWAGDAHFU-QGZVFWFLSA-N |
| XLogP | 4.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|