C15H20N2O2 — CID 11414299
(5R)-1-ethyl-5-methyl-4-[(1R)-1-phenylethyl]piperazine-2,3-dione (PubChem CID 11414299) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is (5R)-1-ethyl-5-methyl-4-[(1R)-1-phenylethyl]piperazine-2,3-dione.
| Compound Name | (5R)-1-ethyl-5-methyl-4-[(1R)-1-phenylethyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 11414299 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (5R)-1-ethyl-5-methyl-4-[(1R)-1-phenylethyl]piperazine-2,3-dione |
| SMILES | CCN1C[C@@H](C)N([C@H](C)c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C15H20N2O2/c1-4-16-10-11(2)17(15(19)14(16)18)12(3)13-8-6-5-7-9-13/h5-9,11-12H,4,10H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | QZGAYXKKJPCOJE-VXGBXAGGSA-N |
| XLogP | 1.83 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|