C17H24N4O7 — CID 102168619
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-azido-5-(cyclopentylideneamino)oxan-2-yl]methyl acetate (PubChem CID 102168619) has the molecular formula C17H24N4O7 and a molecular weight of 396.40 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-azido-5-(cyclopentylideneamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-azido-5-(cyclopentylideneamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102168619 |
| Molecular Formula | C17H24N4O7 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-azido-5-(cyclopentylideneamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](N=[N+]=[N-])[C@H](N=C2CCCC2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H24N4O7/c1-9(22)25-8-13-15(26-10(2)23)16(27-11(3)24)14(17(28-13)20-21-18)19-12-6-4-5-7-12/h13-17H,4-8H2,1-3H3/t13-,14-,15-,16-,17-/m1/s1 |
| InChIKey | YGBCEGOEQHLDLY-WRQOLXDDSA-N |
| XLogP | 1.83 |
| TPSA | 149.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|