C24H27BrO5 — CID 102170386
(E)-1-[5-bromo-4-methoxy-2-(methoxymethoxy)phenyl]-2,2-dimethyl-7-phenylhept-6-ene-1,3-dione (PubChem CID 102170386) has the molecular formula C24H27BrO5 and a molecular weight of 475.38 g/mol. Its IUPAC name is (E)-1-[5-bromo-4-methoxy-2-(methoxymethoxy)phenyl]-2,2-dimethyl-7-phenylhept-6-ene-1,3-dione.
| Compound Name | (E)-1-[5-bromo-4-methoxy-2-(methoxymethoxy)phenyl]-2,2-dimethyl-7-phenylhept-6-ene-1,3-dione |
|---|---|
| PubChem CID | 102170386 |
| Molecular Formula | C24H27BrO5 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | (E)-1-[5-bromo-4-methoxy-2-(methoxymethoxy)phenyl]-2,2-dimethyl-7-phenylhept-6-ene-1,3-dione |
| SMILES | COCOc1cc(OC)c(Br)cc1C(=O)C(C)(C)C(=O)CC/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H27BrO5/c1-24(2,22(26)13-9-8-12-17-10-6-5-7-11-17)23(27)18-14-19(25)21(29-4)15-20(18)30-16-28-3/h5-8,10-12,14-15H,9,13,16H2,1-4H3/b12-8+ |
| InChIKey | HGCVAEXYVITZTO-XYOKQWHBSA-N |
| XLogP | 5.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|