C20H22O5 — CID 59560058
3,5-bis(methoxymethoxy)-4-[(Z)-3-phenylprop-2-enyl]benzaldehyde (PubChem CID 59560058) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is 3,5-bis(methoxymethoxy)-4-[(Z)-3-phenylprop-2-enyl]benzaldehyde.
| Compound Name | 3,5-bis(methoxymethoxy)-4-[(Z)-3-phenylprop-2-enyl]benzaldehyde |
|---|---|
| PubChem CID | 59560058 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 3,5-bis(methoxymethoxy)-4-[(Z)-3-phenylprop-2-enyl]benzaldehyde |
| SMILES | COCOc1cc(C=O)cc(OCOC)c1C/C=C\c1ccccc1 |
| InChI | InChI=1S/C20H22O5/c1-22-14-24-19-11-17(13-21)12-20(25-15-23-2)18(19)10-6-9-16-7-4-3-5-8-16/h3-9,11-13H,10,14-15H2,1-2H3/b9-6- |
| InChIKey | PAYMIGASZRNMLY-TWGQIWQCSA-N |
| XLogP | 3.72 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|