C17H9ClFNO — CID 102172084
5-chloro-2-(4-fluorophenyl)furo[3,2-h]quinoline (PubChem CID 102172084) has the molecular formula C17H9ClFNO and a molecular weight of 297.72 g/mol. Its IUPAC name is 5-chloro-2-(4-fluorophenyl)furo[3,2-h]quinoline.
| Compound Name | 5-chloro-2-(4-fluorophenyl)furo[3,2-h]quinoline |
|---|---|
| PubChem CID | 102172084 |
| Molecular Formula | C17H9ClFNO |
| Molecular Weight | 297.72 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 5-chloro-2-(4-fluorophenyl)furo[3,2-h]quinoline |
| SMILES | Fc1ccc(-c2cc3cc(Cl)c4cccnc4c3o2)cc1 |
| InChI | InChI=1S/C17H9ClFNO/c18-14-8-11-9-15(10-3-5-12(19)6-4-10)21-17(11)16-13(14)2-1-7-20-16/h1-9H |
| InChIKey | QXMFFFLOPIEAOO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.72 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |