C9H15NO — CID 102173697
1-butyl-3,4-dihydropyridin-2-one (PubChem CID 102173697) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 1-butyl-3,4-dihydropyridin-2-one.
| Compound Name | 1-butyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 102173697 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1-butyl-3,4-dihydropyridin-2-one |
| SMILES | CCCCN1C=CCCC1=O |
| InChI | InChI=1S/C9H15NO/c1-2-3-7-10-8-5-4-6-9(10)11/h5,8H,2-4,6-7H2,1H3 |
| InChIKey | YZIPXJFPOVEMNO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |