C24H25NO2 — CID 102173882
2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium (PubChem CID 102173882) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium.
| Compound Name | 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium |
|---|---|
| PubChem CID | 102173882 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-phenanthren-9-ylethenyl]-2,4-dihydropyrrol-1-ium |
| SMILES | CCOC1[N+]([O-])=C(/C=C/c2cc3ccccc3c3ccccc23)CC1(C)C |
| InChI | InChI=1S/C24H25NO2/c1-4-27-23-24(2,3)16-19(25(23)26)14-13-18-15-17-9-5-6-10-20(17)22-12-8-7-11-21(18)22/h5-15,23H,4,16H2,1-3H3/b14-13+ |
| InChIKey | MFKBPSIYJYBNTM-BUHFOSPRSA-N |
| XLogP | 5.75 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|