C26H25NO2 — CID 71717584
2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-pyren-1-ylethenyl]-2,4-dihydropyrrol-1-ium (PubChem CID 71717584) has the molecular formula C26H25NO2 and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-pyren-1-ylethenyl]-2,4-dihydropyrrol-1-ium.
| Compound Name | 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-pyren-1-ylethenyl]-2,4-dihydropyrrol-1-ium |
|---|---|
| PubChem CID | 71717584 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 2-ethoxy-3,3-dimethyl-1-oxido-5-[(E)-2-pyren-1-ylethenyl]-2,4-dihydropyrrol-1-ium |
| SMILES | CCOC1[N+]([O-])=C(/C=C/c2ccc3ccc4cccc5ccc2c3c45)CC1(C)C |
| InChI | InChI=1S/C26H25NO2/c1-4-29-25-26(2,3)16-21(27(25)28)14-12-17-8-9-20-11-10-18-6-5-7-19-13-15-22(17)24(20)23(18)19/h5-15,25H,4,16H2,1-3H3/b14-12+ |
| InChIKey | ZNIQEGWJQOKDMF-WYMLVPIESA-N |
| XLogP | 6.34 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|