C15H16N2O2 — CID 102173915
3-diazo-1-(3,6,7,8-tetrahydro-1H-cyclopenta[e][2]benzofuran-7-yl)butan-2-one (PubChem CID 102173915) has the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-diazo-1-(3,6,7,8-tetrahydro-1H-cyclopenta[e][2]benzofuran-7-yl)butan-2-one.
| Compound Name | 3-diazo-1-(3,6,7,8-tetrahydro-1H-cyclopenta[e][2]benzofuran-7-yl)butan-2-one |
|---|---|
| PubChem CID | 102173915 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3-diazo-1-(3,6,7,8-tetrahydro-1H-cyclopenta[e][2]benzofuran-7-yl)butan-2-one |
| SMILES | CC(=[N+]=[N-])C(=O)CC1Cc2ccc3c(c2C1)COC3 |
| InChI | InChI=1S/C15H16N2O2/c1-9(17-16)15(18)6-10-4-11-2-3-12-7-19-8-14(12)13(11)5-10/h2-3,10H,4-8H2,1H3 |
| InChIKey | LPYVVHXAOJCZTP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|