C10H16O3 — CID 102174448
(2S)-2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]propanoic acid (PubChem CID 102174448) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (2S)-2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]propanoic acid.
| Compound Name | (2S)-2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 102174448 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (2S)-2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]propanoic acid |
| SMILES | C=C[C@@]1(C)CC[C@@H]([C@H](C)C(=O)O)O1 |
| InChI | InChI=1S/C10H16O3/c1-4-10(3)6-5-8(13-10)7(2)9(11)12/h4,7-8H,1,5-6H2,2-3H3,(H,11,12)/t7-,8-,10-/m0/s1 |
| InChIKey | SEGYPOKUPWNPPY-NRPADANISA-N |
| XLogP | 1.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|