C11H18O3 — CID 162966177
(3R)-3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butanoic acid (PubChem CID 162966177) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (3R)-3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butanoic acid.
| Compound Name | (3R)-3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butanoic acid |
|---|---|
| PubChem CID | 162966177 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (3R)-3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butanoic acid |
| SMILES | C=C[C@@]1(C)CC[C@@H]([C@H](C)CC(=O)O)O1 |
| InChI | InChI=1S/C11H18O3/c1-4-11(3)6-5-9(14-11)8(2)7-10(12)13/h4,8-9H,1,5-7H2,2-3H3,(H,12,13)/t8-,9+,11+/m1/s1 |
| InChIKey | NAJZTTOYWJQEQW-YWVKMMECSA-N |
| XLogP | 2.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|