C20H36O7 — CID 102174736
methyl 3-hydroxy-3-methyl-5,8-bis(oxan-2-yloxy)octanoate (PubChem CID 102174736) has the molecular formula C20H36O7 and a molecular weight of 388.50 g/mol. Its IUPAC name is methyl 3-hydroxy-3-methyl-5,8-bis(oxan-2-yloxy)octanoate.
| Compound Name | methyl 3-hydroxy-3-methyl-5,8-bis(oxan-2-yloxy)octanoate |
|---|---|
| PubChem CID | 102174736 |
| Molecular Formula | C20H36O7 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | methyl 3-hydroxy-3-methyl-5,8-bis(oxan-2-yloxy)octanoate |
| SMILES | COC(=O)CC(C)(O)CC(CCCOC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C20H36O7/c1-20(22,15-17(21)23-2)14-16(27-19-10-4-6-12-26-19)8-7-13-25-18-9-3-5-11-24-18/h16,18-19,22H,3-15H2,1-2H3 |
| InChIKey | LWINUXWQFFWJFC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|