C21H44O8P2 — CID 91259156
2-[4,4-bis[di(propan-2-yloxy)phosphoryl]butoxy]oxane (PubChem CID 91259156) has the molecular formula C21H44O8P2 and a molecular weight of 486.52 g/mol. Its IUPAC name is 2-[4,4-bis[di(propan-2-yloxy)phosphoryl]butoxy]oxane.
| Compound Name | 2-[4,4-bis[di(propan-2-yloxy)phosphoryl]butoxy]oxane |
|---|---|
| PubChem CID | 91259156 |
| Molecular Formula | C21H44O8P2 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 2-[4,4-bis[di(propan-2-yloxy)phosphoryl]butoxy]oxane |
| SMILES | CC(C)OP(=O)(OC(C)C)C(CCCOC1CCCCO1)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C21H44O8P2/c1-16(2)26-30(22,27-17(3)4)21(31(23,28-18(5)6)29-19(7)8)13-11-15-25-20-12-9-10-14-24-20/h16-21H,9-15H2,1-8H3 |
| InChIKey | SLBIBDSLUFVVKS-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|