C15H9NO6 — CID 102175571
3-[(E)-2-(furan-2-yl)-1-nitroethenyl]-3-hydroxyindene-1,2-dione (PubChem CID 102175571) has the molecular formula C15H9NO6 and a molecular weight of 299.24 g/mol. Its IUPAC name is 3-[(E)-2-(furan-2-yl)-1-nitroethenyl]-3-hydroxyindene-1,2-dione.
| Compound Name | 3-[(E)-2-(furan-2-yl)-1-nitroethenyl]-3-hydroxyindene-1,2-dione |
|---|---|
| PubChem CID | 102175571 |
| Molecular Formula | C15H9NO6 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 3-[(E)-2-(furan-2-yl)-1-nitroethenyl]-3-hydroxyindene-1,2-dione |
| SMILES | O=C1C(=O)C(O)(/C(=C\c2ccco2)[N+](=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C15H9NO6/c17-13-10-5-1-2-6-11(10)15(19,14(13)18)12(16(20)21)8-9-4-3-7-22-9/h1-8,19H/b12-8+ |
| InChIKey | OPMOWPWRUGRJDC-XYOKQWHBSA-N |
| XLogP | 1.55 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|