C17H16O2 — CID 102176753
(2R)-2-benzyl-2-hydroxy-3,4-dihydronaphthalen-1-one (PubChem CID 102176753) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is (2R)-2-benzyl-2-hydroxy-3,4-dihydronaphthalen-1-one.
| Compound Name | (2R)-2-benzyl-2-hydroxy-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 102176753 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (2R)-2-benzyl-2-hydroxy-3,4-dihydronaphthalen-1-one |
| SMILES | O=C1c2ccccc2CC[C@@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C17H16O2/c18-16-15-9-5-4-8-14(15)10-11-17(16,19)12-13-6-2-1-3-7-13/h1-9,19H,10-12H2/t17-/m1/s1 |
| InChIKey | KIMBDSCWSZGJRZ-QGZVFWFLSA-N |
| XLogP | 2.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |