C17H28O3 — CID 102176837
methyl 6-hydroxy-6-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)hexanoate (PubChem CID 102176837) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is methyl 6-hydroxy-6-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)hexanoate.
| Compound Name | methyl 6-hydroxy-6-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)hexanoate |
|---|---|
| PubChem CID | 102176837 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | methyl 6-hydroxy-6-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)hexanoate |
| SMILES | COC(=O)CCCCC(O)C1(C)C(C)=C(C)C(C)=C1C |
| InChI | InChI=1S/C17H28O3/c1-11-12(2)14(4)17(5,13(11)3)15(18)9-7-8-10-16(19)20-6/h15,18H,7-10H2,1-6H3 |
| InChIKey | DQJQLBMGZOYITR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|